2-Methoxy-1(2H)-quinolinecarboxylic acid isopropyl ester structure
|
Common Name | 2-Methoxy-1(2H)-quinolinecarboxylic acid isopropyl ester | ||
|---|---|---|---|---|
| CAS Number | 30831-72-2 | Molecular Weight | 247.29000 | |
| Density | 1.16g/cm3 | Boiling Point | 349.6ºC at 760 mmHg | |
| Molecular Formula | C14H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.2ºC | |
| Name | propan-2-yl 2-methoxy-2H-quinoline-1-carboxylate |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 349.6ºC at 760 mmHg |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29000 |
| Flash Point | 165.2ºC |
| Exact Mass | 247.12100 |
| PSA | 38.77000 |
| LogP | 3.10230 |
| Index of Refraction | 1.562 |
| InChIKey | CCWOKFNOLILVKD-UHFFFAOYSA-N |
| SMILES | COC1C=Cc2ccccc2N1C(=O)OC(C)C |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |