tris(2-hydroxyethyl)ammonium octyl sulphate structure
|
Common Name | tris(2-hydroxyethyl)ammonium octyl sulphate | ||
|---|---|---|---|---|
| CAS Number | 30862-34-1 | Molecular Weight | 359.479 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H33NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Triethanolamine octyl sulfate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H33NO7S |
|---|---|
| Molecular Weight | 359.479 |
| Exact Mass | 359.197784 |
| InChIKey | JKLVJVFMOYDRNL-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOS(=O)(=O)O.OCCN(CCO)CCO |
| tris(2-hydroxyethyl)ammonium octyl sulphate |
| EINECS 250-364-1 |
| Tris(2-hydroxyethyl)ammonium capryl sulphate |
| Sulfuric acid, octyl ester, compd. with 2,2',2''-nitrilotris[ethanol] (1:1) |
| 2-Hydroxy-N,N-bis(2-hydroxyethyl)ethanaminium octyl sulfate |
| Triethanolamine octyl sulfate |
| Octyl hydrogen sulfate - 2,2',2''-nitrilotriethanol (1:1) |
| Sulfuric acid, monooctyl ester, compd. with 2,2′,2′′-nitrilotris[ethanol] (1:1) |