[4-(diethylamino)-6-(diethylcarbamothioylsulfanyl)-1,3,5-triazin-2-yl] N,N-diethylcarbamodithioate structure
|
Common Name | [4-(diethylamino)-6-(diethylcarbamothioylsulfanyl)-1,3,5-triazin-2-yl] N,N-diethylcarbamodithioate | ||
|---|---|---|---|---|
| CAS Number | 30863-11-7 | Molecular Weight | 446.72000 | |
| Density | 1.26g/cm3 | Boiling Point | 571.8ºC at 760mmHg | |
| Molecular Formula | C17H30N6S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.6ºC | |
| Name | [4-(diethylamino)-6-(diethylcarbamothioylsulfanyl)-1,3,5-triazin-2-yl] N,N-diethylcarbamodithioate |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 571.8ºC at 760mmHg |
| Molecular Formula | C17H30N6S4 |
| Molecular Weight | 446.72000 |
| Flash Point | 299.6ºC |
| Exact Mass | 446.14100 |
| PSA | 163.17000 |
| LogP | 4.15540 |
| Index of Refraction | 1.635 |
| InChIKey | OYHLBTGDOSPZKH-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=S)Sc1nc(SC(=S)N(CC)CC)nc(N(CC)CC)n1 |
|
~%
[4-(diethylamin... CAS#:30863-11-7 |
| Literature: D'Amico; Harman Journal of the American Chemical Society, 1956 , vol. 78, p. 5345,5348 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |