2,4-diethoxy-6-(trichloromethyl)-1,3,5-triazine structure
|
Common Name | 2,4-diethoxy-6-(trichloromethyl)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 30863-40-2 | Molecular Weight | 286.54300 | |
| Density | 1.422g/cm3 | Boiling Point | 340.9ºC at 760mmHg | |
| Molecular Formula | C8H10Cl3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160ºC | |
| Name | 2,4-diethoxy-6-(trichloromethyl)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.422g/cm3 |
|---|---|
| Boiling Point | 340.9ºC at 760mmHg |
| Molecular Formula | C8H10Cl3N3O2 |
| Molecular Weight | 286.54300 |
| Flash Point | 160ºC |
| Exact Mass | 284.98400 |
| PSA | 57.13000 |
| LogP | 2.49570 |
| Index of Refraction | 1.529 |
| InChIKey | RGVXGKJJCBRHTP-UHFFFAOYSA-N |
| SMILES | CCOc1nc(OCC)nc(C(Cl)(Cl)Cl)n1 |
|
~%
2,4-diethoxy-6-... CAS#:30863-40-2 |
| Literature: Schroeder Journal of the American Chemical Society, 1959 , vol. 81, p. 5658,5662 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,4-Bis-ethoxy-6-trichlormethyl-s-triazin |
| 2,4-Diethoxy-6-trichlormethyl-s-triazin |