Methyl [4-(hydroxymethyl)-2-nitrophenoxy]acetate structure
|
Common Name | Methyl [4-(hydroxymethyl)-2-nitrophenoxy]acetate | ||
|---|---|---|---|---|
| CAS Number | 308815-81-8 | Molecular Weight | 241.197 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 423.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H11NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.9±25.9 °C | |
| Name | methyl 2-[4-(hydroxymethyl)-2-nitrophenoxy]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 423.4±35.0 °C at 760 mmHg |
| Molecular Formula | C10H11NO6 |
| Molecular Weight | 241.197 |
| Flash Point | 209.9±25.9 °C |
| Exact Mass | 241.058640 |
| PSA | 101.58000 |
| LogP | -0.18 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | HNFVHTJFCGBTSS-UHFFFAOYSA-N |
| SMILES | COC(=O)COc1ccc(CO)cc1[N+](=O)[O-] |
| HS Code | 2918990090 |
|---|
|
~%
Methyl [4-(hydr... CAS#:308815-81-8 |
| Literature: Synlett, , # 9 p. 1241 - 1244 |
|
~%
Methyl [4-(hydr... CAS#:308815-81-8 |
| Literature: Synlett, , # 9 p. 1241 - 1244 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| H1049 |
| Methyl [4-(hydroxymethyl)-2-nitrophenoxy]acetate |
| Methyl 2-[4-(HydroxyMethyl)-2-nitrophenoxy]acetate |
| MFCD04117920 |
| Acetic acid, 2-[4-(hydroxymethyl)-2-nitrophenoxy]-, methyl ester |