Pregna-1,4-diene-3,20-dione,9-fluoro-11,21-dihydroxy-16,17-[(1-phenylethylidene)bis(oxy)]-, (11b,16a)- (9CI) structure
|
Common Name | Pregna-1,4-diene-3,20-dione,9-fluoro-11,21-dihydroxy-16,17-[(1-phenylethylidene)bis(oxy)]-, (11b,16a)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 3092-82-8 | Molecular Weight | 496.56700 | |
| Density | 1.35g/cm3 | Boiling Point | 650.5ºC at 760mmHg | |
| Molecular Formula | C29H33FO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.2ºC | |
| Name | Tricinolone acetophenonide |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 650.5ºC at 760mmHg |
| Molecular Formula | C29H33FO6 |
| Molecular Weight | 496.56700 |
| Flash Point | 347.2ºC |
| Exact Mass | 496.22600 |
| PSA | 93.06000 |
| LogP | 3.55560 |
| Index of Refraction | 1.623 |
| InChIKey | HCKFPALGXKOOBK-ZPHQKVKWSA-N |
| SMILES | CC1(c2ccccc2)OC2CC3C4CCC5=CC(=O)C=CC5(C)C4(F)C(O)CC3(C)C2(C(=O)CO)O1 |
|
~%
Pregna-1,4-dien... CAS#:3092-82-8 |
| Literature: Fried et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 2338 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |