Acetamide,2,2'-dithiobis[N-phenyl
Acetamide,2,2'-dithiobis[N-phenyl structure
|
Common Name | Acetamide,2,2'-dithiobis[N-phenyl | ||
|---|---|---|---|---|
| CAS Number | 3095-79-2 | Molecular Weight | 332.44000 | |
| Density | 1.36g/cm3 | Boiling Point | 606.6ºC at 760 mmHg | |
| Molecular Formula | C16H16N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.7ºC | |
Summary: N-Phenyl-mercaptoacetamide disulfide, also known as Acetamide,2,2'-dithiobis[N-phenyl-], with CAS number 3095-79-2, has a molecular formula of C16H16N2O2S2 and a molecular weight of 332.44000. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-phenyl-mercaptoacetamide disulfide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 606.6ºC at 760 mmHg |
| Molecular Formula | C16H16N2O2S2 |
| Molecular Weight | 332.44000 |
| Flash Point | 320.7ºC |
| Exact Mass | 332.06500 |
| PSA | 108.80000 |
| LogP | 3.79120 |
| Index of Refraction | 1.704 |
| InChIKey | NDAWAPCWGLWEGN-UHFFFAOYSA-N |
| SMILES | O=C(CSSCC(=O)Nc1ccccc1)Nc1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 3 | |
CAS#:4822-44-0![Carbamothioic acid,S-[2-oxo-2-(phenylamino)ethyl] ester Structure](https://image.chemsrc.com/caspic/340/5428-95-5.png)
CAS#:5428-95-5
CAS#:505-73-7
CAS#:65291-49-8
CAS#:10021-77-9
CAS#:7732-18-5
CAS#:7758-99-8
CAS#:64-17-5
CAS#:620-81-5
CAS#:78121-70-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Disulfandiyldi-essigsaeure-dianilid |
| Dithiodiessigsaeure-dianilid |
| Bis-anilinocarbonylmethyl-disulfid |
| disulfanediyldi-acetic acid dianilide |
| Dithiodiglykolsaeure-dianilid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-phenyl-mercaptoacetamide disulfide? |
| A: Molecular weight of N-phenyl-mercaptoacetamide disulfide is 332.44000. |
| Q: What is the boiling point of N-phenyl-mercaptoacetamide disulfide? |
| A: Boiling point of N-phenyl-mercaptoacetamide disulfide is 606.6ºC at 760 mmHg. |
| Q: What are the downstream products of N-phenyl-mercaptoacetamide disulfide? |
| A: Related downstream products(CAS) of N-phenyl-mercaptoacetamide disulfide: 4822-44-0;620-81-5;78121-70-7. |
| Q: What is the CAS number of N-phenyl-mercaptoacetamide disulfide? |
| A: CAS number of N-phenyl-mercaptoacetamide disulfide is 3095-79-2. |
| Q: What are the upstream materials of N-phenyl-mercaptoacetamide disulfide? |
| A: Related upstream materials(CAS) of N-phenyl-mercaptoacetamide disulfide: 4822-44-0;5428-95-5;505-73-7;65291-49-8;10021-77-9;7732-18-5;7758-99-8;64-17-5. |
| Q: What is the LogP of N-phenyl-mercaptoacetamide disulfide? |
| A: LogP of N-phenyl-mercaptoacetamide disulfide is 3.79120. |
| Q: What is the InChIKey of N-phenyl-mercaptoacetamide disulfide? |
| A: InChIKey of N-phenyl-mercaptoacetamide disulfide is NDAWAPCWGLWEGN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-phenyl-mercaptoacetamide disulfide? |
| A: SMILES notation of N-phenyl-mercaptoacetamide disulfide is O=C(CSSCC(=O)Nc1ccccc1)Nc1ccccc1. |
| Q: What English synonyms does N-phenyl-mercaptoacetamide disulfide have? |
| A: English synonyms of N-phenyl-mercaptoacetamide disulfide: Disulfandiyldi-essigsaeure-dianilid, Dithiodiessigsaeure-dianilid, Bis-anilinocarbonylmethyl-disulfid, disulfanediyldi-acetic acid dianilide, Dithiodiglykolsaeure-dianilid. |
| Q: What is the molecular formula of N-phenyl-mercaptoacetamide disulfide? |
| A: Molecular formula of N-phenyl-mercaptoacetamide disulfide is C16H16N2O2S2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |