PP2 analog structure
|
Common Name | PP2 analog | ||
|---|---|---|---|---|
| CAS Number | 309739-67-1 | Molecular Weight | 300.79 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PP2 analogPP2 analog is the analog of PP2,a Src family kinase inhibitor. |
| Name | PP2 analog |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17ClN4 |
|---|---|
| Molecular Weight | 300.79 |
| Exact Mass | 300.114 |
| InChIKey | CYTZASCNUGMIJP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)n1cc(-c2ccc(Cl)cc2)c2c(N)ncnc21 |
| 7-tert-butyl-5-(4-chlorophenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| CHEMBL306012 |