methyl 1-methyl-4-nitro-1H-pyrazole-5-carboxylate structure
|
Common Name | methyl 1-methyl-4-nitro-1H-pyrazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 309740-49-6 | Molecular Weight | 185.13700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H7N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-methyl-4-nitropyrazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H7N3O4 |
|---|---|
| Molecular Weight | 185.13700 |
| Exact Mass | 185.04400 |
| PSA | 89.94000 |
| LogP | 0.63810 |
| InChIKey | ANWHCLPGJQUYRX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c([N+](=O)[O-])cnn1C |
| HS Code | 2933199090 |
|---|
|
~32%
methyl 1-methyl... CAS#:309740-49-6 |
| Literature: KOREA RESEARCH INSTITUTE OF CHEMICAL TECHNOLOGY Patent: US2010/63106 A1, 2010 ; Location in patent: Page/Page column 11;13 ; |
|
~84%
methyl 1-methyl... CAS#:309740-49-6 |
| Literature: KALYPSYS, INC. Patent: WO2009/26241 A1, 2009 ; Location in patent: Page/Page column 66-67 ; WO 2009/026241 A1 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 1-methyl-4-nitro-1H-pyrazole-5-carboxylate |
| 4-nitro-2-methyl-2H-pyrazole-3-carboxylic acid methyl ester |
| methyl 1-methyl-4-nitro-5-pyrazolecarboxylate |
| 2-methyl-4-nitro-2H-pyrazole-3-carboxylic acid methyl ester |
| methyl 1-methyl-4-nitropyrazole-5-carboxylate |