CID 119089544
Modify Date: 2026-08-20 19:49:35
CID 119089544 structure
|
Common Name | CID 119089544 | ||
|---|---|---|---|---|
| CAS Number | 30980-52-0 | Molecular Weight | 199.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H5N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 119089544 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H5N3O2 |
|---|---|
| Molecular Weight | 199.17 |
| InChIKey | RXSNCYVOPPFYAP-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc2c([N+](=O)[O-])cccc2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of CID 119089544? |
| A: InChIKey of CID 119089544 is RXSNCYVOPPFYAP-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 30980-52-0? |
| A: Chinese name of 30980-52-0 is 30980-52-0. |
| Q: What is the CAS number of CID 119089544? |
| A: CAS number of CID 119089544 is 30980-52-0. |
| Q: What is the molecular weight of CID 119089544? |
| A: Molecular weight of CID 119089544 is 199.17. |
| Q: What is the molecular formula of CID 119089544? |
| A: Molecular formula of CID 119089544 is C10H5N3O2. |
| Q: What is the SMILES notation of CID 119089544? |
| A: SMILES notation of CID 119089544 is N#Cc1ccc2c([N+](=O)[O-])cccc2n1. |
| Q: What is the English name of CID 119089544? |
| A: The English name of CID 119089544 is CID 119089544. |