1,4-Pentadien-3-one,1,5-bis(3,4-dichlorophenyl)-, (E,E)- (8CI,9CI) structure
|
Common Name | 1,4-Pentadien-3-one,1,5-bis(3,4-dichlorophenyl)-, (E,E)- (8CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 30983-80-3 | Molecular Weight | 372.07300 | |
| Density | 1.427g/cm3 | Boiling Point | 527.9ºC at 760mmHg | |
| Molecular Formula | C17H10Cl4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.1ºC | |
| Name | (1E,4E)-1,5-bis(3,4-dichlorophenyl)penta-1,4-dien-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.427g/cm3 |
|---|---|
| Boiling Point | 527.9ºC at 760mmHg |
| Molecular Formula | C17H10Cl4O |
| Molecular Weight | 372.07300 |
| Flash Point | 220.1ºC |
| Exact Mass | 369.94900 |
| PSA | 17.07000 |
| LogP | 6.59590 |
| Index of Refraction | 1.668 |
| InChIKey | PEIXSRCYWCYQCA-IJIVKGSJSA-N |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)C=Cc1ccc(Cl)c(Cl)c1 |
|
~99%
1,4-Pentadien-3... CAS#:30983-80-3 |
| Literature: Costi, Roberta; Di Santo, Roberto; Artico, Marino; Massa, Silvio; Ragno, Rino; Loddo, Roberta; La Colla, Massimiliano; Tramontano, Enzo; La Colla, Paolo; Pani, Alessandra Bioorganic and Medicinal Chemistry, 2004 , vol. 12, # 1 p. 199 - 215 |
| Bis-3,4-Dichlorbenzyliden-aceton |