5-bromo-N-cyclooctylfuran-2-carboxamide
Modify Date: 2025-10-04 08:54:17
5-bromo-N-cyclooctylfuran-2-carboxamide structure
|
Common Name | 5-bromo-N-cyclooctylfuran-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 310453-09-9 | Molecular Weight | 300.19200 | |
| Density | 1.36g/cm3 | Boiling Point | 402.1ºC at 760 mmHg | |
| Molecular Formula | C13H18BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197ºC | |
| Name | 5-bromo-N-cyclooctylfuran-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 402.1ºC at 760 mmHg |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.19200 |
| Flash Point | 197ºC |
| Exact Mass | 299.05200 |
| PSA | 42.24000 |
| LogP | 4.27570 |
| Index of Refraction | 1.553 |
| InChIKey | QHJMYECJBHGFHH-UHFFFAOYSA-N |
| SMILES | O=C(NC1CCCCCCC1)c1ccc(Br)o1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-bromo-N-cyclooctyl-2-furamide |