Benzoic acid,4-chloro-, 2-(phenylmethylene)hydrazide structure
|
Common Name | Benzoic acid,4-chloro-, 2-(phenylmethylene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 31061-81-1 | Molecular Weight | 258.70300 | |
| Density | 1.19g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(phenylmethylene)-(4-chloro)benzoic acid hydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 258.70300 |
| Exact Mass | 258.05600 |
| PSA | 41.46000 |
| LogP | 3.49480 |
| Index of Refraction | 1.592 |
| InChIKey | UDQISSHIEPUOLJ-UHFFFAOYSA-N |
| SMILES | O=C(NN=Cc1ccccc1)c1ccc(Cl)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-Chlor-benzoesaeure-benzylidenhydrazid |
| 4-chloro-benzoic acid benzylidenehydrazide |