butyl prop-2-enoate,2-ethylhexyl prop-2-enoate,2-methylprop-2-enoic acid structure
|
Common Name | butyl prop-2-enoate,2-ethylhexyl prop-2-enoate,2-methylprop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 31071-53-1 | Molecular Weight | 398.53400 | |
| Density | N/A | Boiling Point | 216ºC at 760mmHg | |
| Molecular Formula | C22H38O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 79.4ºC | |
| Name | butyl prop-2-enoate,2-ethylhexyl prop-2-enoate,2-methylprop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 216ºC at 760mmHg |
|---|---|
| Molecular Formula | C22H38O6 |
| Molecular Weight | 398.53400 |
| Flash Point | 79.4ºC |
| Exact Mass | 398.26700 |
| PSA | 89.90000 |
| LogP | 5.09480 |
| InChIKey | BKLZUESYKYKHGH-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)O.C=CC(=O)OCC(CC)CCCC.C=CC(=O)OCCCC |
| 2-Propenoic acid,2-methyl-,polymer with butyl 2-propenoate and 2-ethylhexyl 2-propenoate |
| butyl prop-2-enoate |
| 2-Propenoic acid,2-ethylhexyl ester,polymer with butyl 2-propenoate and 2-methyl-2-propenoic acid |