1,3-Diiodo-2-methoxy-5-nitrobenzene structure
|
Common Name | 1,3-Diiodo-2-methoxy-5-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 31106-75-9 | Molecular Weight | 404.92800 | |
| Density | 2.39 g/cm3 | Boiling Point | 421.8ºC at 760 mmHg | |
| Molecular Formula | C7H5I2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.9ºC | |
| Name | 1,3-Diiodo-2-methoxy-5-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.39 g/cm3 |
|---|---|
| Boiling Point | 421.8ºC at 760 mmHg |
| Molecular Formula | C7H5I2NO3 |
| Molecular Weight | 404.92800 |
| Flash Point | 208.9ºC |
| Exact Mass | 404.83600 |
| PSA | 55.05000 |
| LogP | 3.33580 |
| Index of Refraction | 1.697 |
| InChIKey | LHCXPILOHPAXIN-UHFFFAOYSA-N |
| SMILES | COc1c(I)cc([N+](=O)[O-])cc1I |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,6-diiodo-4-nitro-anisole |
| 1-methoxy-2,6-diiodido-4-nitrobenzene |
| 2.6-Dijod-4-nitro-1-methoxy-benzol |
| 2,6-Dijod-4-nitro-anisol |