N-[p-[2-(Diisopropylamino)ethoxy]phenyl]-N'-(2,3-xylyl)benzamidine structure
|
Common Name | N-[p-[2-(Diisopropylamino)ethoxy]phenyl]-N'-(2,3-xylyl)benzamidine | ||
|---|---|---|---|---|
| CAS Number | 31109-83-8 | Molecular Weight | 443.62400 | |
| Density | 1.01g/cm3 | Boiling Point | 589.8ºC at 760mmHg | |
| Molecular Formula | C29H37N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.5ºC | |
| Name | N'-(2,3-dimethylphenyl)-N-[4-[2-[di(propan-2-yl)amino]ethoxy]phenyl]benzenecarboximidamide |
|---|
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 589.8ºC at 760mmHg |
| Molecular Formula | C29H37N3O |
| Molecular Weight | 443.62400 |
| Flash Point | 310.5ºC |
| Exact Mass | 443.29400 |
| PSA | 36.86000 |
| LogP | 7.06440 |
| Index of Refraction | 1.551 |
| InChIKey | CFWSYWPDFJAIFK-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N=C(Nc2ccc(OCCN(C(C)C)C(C)C)cc2)c2ccccc2)c1C |
|
~40%
N-[p-[2-(Diisop... CAS#:31109-83-8 |
| Literature: Shroff; Elpern; Kobrin; Cervoni Journal of Medicinal Chemistry, 1982 , vol. 25, # 4 p. 359 - 362 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |