3-[(3,5-dichlorobenzoyl)amino]-2-hydroxy-3-methylbutanoic acid structure
|
Common Name | 3-[(3,5-dichlorobenzoyl)amino]-2-hydroxy-3-methylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 31110-42-6 | Molecular Weight | 306.14200 | |
| Density | 1.442g/cm3 | Boiling Point | 487.7ºC at 760mmHg | |
| Molecular Formula | C12H13Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.7ºC | |
| Name | 3-[(3,5-dichlorobenzoyl)amino]-2-hydroxy-3-methylbutanoic acid |
|---|
| Density | 1.442g/cm3 |
|---|---|
| Boiling Point | 487.7ºC at 760mmHg |
| Molecular Formula | C12H13Cl2NO4 |
| Molecular Weight | 306.14200 |
| Flash Point | 248.7ºC |
| Exact Mass | 305.02200 |
| PSA | 90.12000 |
| LogP | 2.52210 |
| Index of Refraction | 1.585 |
| InChIKey | BEYJASDJHZYFRD-UHFFFAOYSA-N |
| SMILES | CC(C)(NC(=O)c1cc(Cl)cc(Cl)c1)C(O)C(=O)O |
|
~67%
3-[(3,5-dichlor... CAS#:31110-42-6 |
| Literature: Michelotti, Enrique L.; Borrell, Jose I.; Roemmele, Renee; Matallana, Josep L.; Teixido, Jordi; Bryman, Lois M. Journal of Agricultural and Food Chemistry, 2002 , vol. 50, # 3 p. 495 - 498 |
|
~%
3-[(3,5-dichlor... CAS#:31110-42-6 |
| Literature: Michelotti, Enrique L.; Borrell, Jose I.; Roemmele, Renee; Matallana, Josep L.; Teixido, Jordi; Bryman, Lois M. Journal of Agricultural and Food Chemistry, 2002 , vol. 50, # 3 p. 495 - 498 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |