N'-(p-Chlorophenyl)-N-[p-[2-(diisopropylamino)ethoxy]phenyl]benzamidine structure
|
Common Name | N'-(p-Chlorophenyl)-N-[p-[2-(diisopropylamino)ethoxy]phenyl]benzamidine | ||
|---|---|---|---|---|
| CAS Number | 31118-17-9 | Molecular Weight | 450.01500 | |
| Density | 1.08g/cm3 | Boiling Point | 581.1ºC at 760mmHg | |
| Molecular Formula | C27H32ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.3ºC | |
| Name | N'-(4-chlorophenyl)-N-[4-[2-[di(propan-2-yl)amino]ethoxy]phenyl]benzenecarboximidamide |
|---|
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 581.1ºC at 760mmHg |
| Molecular Formula | C27H32ClN3O |
| Molecular Weight | 450.01500 |
| Flash Point | 305.3ºC |
| Exact Mass | 449.22300 |
| PSA | 36.86000 |
| LogP | 7.10100 |
| Index of Refraction | 1.564 |
| InChIKey | BGVXVPWRMXNYGV-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCOc1ccc(NC(=Nc2ccc(Cl)cc2)c2ccccc2)cc1)C(C)C |
| HS Code | 2925290090 |
|---|
|
~41%
N'-(p-Chlorophe... CAS#:31118-17-9 |
| Literature: Shroff; Elpern; Kobrin; Cervoni Journal of Medicinal Chemistry, 1982 , vol. 25, # 4 p. 359 - 362 |
|
~%
N'-(p-Chlorophe... CAS#:31118-17-9 |
| Literature: US Vitamins Patent: DE2036181 , 1971 ; Chem.Abstr., 1971 , vol. 74, # 99671 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |