3,4-bis-benzyloxy-benzaldehyde oxime structure
|
Common Name | 3,4-bis-benzyloxy-benzaldehyde oxime | ||
|---|---|---|---|---|
| CAS Number | 31123-05-4 | Molecular Weight | 333.38000 | |
| Density | 1.11 g/cm3 | Boiling Point | 498.2ºC at 760 mmHg | |
| Molecular Formula | C21H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.1ºC | |
| Name | 3,4-bis-benzyloxy-benzaldehyde oxime |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11 g/cm3 |
|---|---|
| Boiling Point | 498.2ºC at 760 mmHg |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.38000 |
| Flash Point | 255.1ºC |
| Exact Mass | 333.13600 |
| PSA | 51.05000 |
| LogP | 4.65270 |
| Index of Refraction | 1.569 |
| InChIKey | BTTPSAYYBOVDKX-UHFFFAOYSA-N |
| SMILES | ON=Cc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| HS Code | 2928000090 |
|---|
|
~%
3,4-bis-benzylo... CAS#:31123-05-4 |
| Literature: RANBAXY LABORATORIES LIMITED Patent: WO2006/85212 A2, 2006 ; Location in patent: Page/Page column 50 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3,4-Dibenzoxybenzaldoxim |
| 3,4-diazatricyclo<4.2.1.02,5>non-3-ene |