2-Chloro-4-nitrobenzenesulfonamide structure
|
Common Name | 2-Chloro-4-nitrobenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 31150-99-9 | Molecular Weight | 236.63300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5ClN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Chloro-4-nitrobenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H5ClN2O4S |
|---|---|
| Molecular Weight | 236.63300 |
| Exact Mass | 235.96600 |
| PSA | 114.36000 |
| LogP | 3.19990 |
| InChIKey | QHVQQUVAILWCLB-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc([N+](=O)[O-])cc1Cl |
| Storage condition | 2-8°C |
| HS Code | 2935009090 |
|---|
|
~%
2-Chloro-4-nitr... CAS#:31150-99-9 |
| Literature: Baker; Dodson; Riegel Journal of the American Chemical Society, 1946 , vol. 68, p. 2636,2638 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 2-Chlor-4-nitro-benzolsulfonsaeureamid |
| 2-Sulfamoyl-5-nitro-chlorbenzol |
| 2-chloro-4-nitro-benzenesulfonic acid amide |
| 2-chloro-4-nitro-benzenesulfonamide |
| 2-Chlor-4-nitro-benzol-sulfonamid |