4-[2-(3-nitrophenoxy)ethoxy]benzenesulfonyl fluoride structure
|
Common Name | 4-[2-(3-nitrophenoxy)ethoxy]benzenesulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 31185-40-7 | Molecular Weight | 341.31200 | |
| Density | 1.416g/cm3 | Boiling Point | 503.2ºC at 760 mmHg | |
| Molecular Formula | C14H12FNO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.1ºC | |
| Name | 4-[2-(3-nitrophenoxy)ethoxy]benzenesulfonyl fluoride |
|---|
| Density | 1.416g/cm3 |
|---|---|
| Boiling Point | 503.2ºC at 760 mmHg |
| Molecular Formula | C14H12FNO6S |
| Molecular Weight | 341.31200 |
| Flash Point | 258.1ºC |
| Exact Mass | 341.03700 |
| PSA | 106.80000 |
| LogP | 4.31480 |
| Index of Refraction | 1.571 |
| InChIKey | NCBRPXNRRMTQKK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(OCCOc2ccc(S(=O)(=O)F)cc2)c1 |
|
~%
4-[2-(3-nitroph... CAS#:31185-40-7 |
| Literature: Baker,B.R.; Ashton,W.T. Journal of Medicinal Chemistry, 1970 , vol. 13, # 6 p. 1149 - 1154 |
|
~%
4-[2-(3-nitroph... CAS#:31185-40-7 |
| Literature: Baker,B.R.; Ashton,W.T. Journal of Medicinal Chemistry, 1970 , vol. 13, # 6 p. 1149 - 1154 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |