N-(1-adamantyl)-2,2,2-trifluoroethanimine structure
|
Common Name | N-(1-adamantyl)-2,2,2-trifluoroethanimine | ||
|---|---|---|---|---|
| CAS Number | 31185-52-1 | Molecular Weight | 231.25700 | |
| Density | 1.4g/cm3 | Boiling Point | 234.1ºC at 760 mmHg | |
| Molecular Formula | C12H16F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.4ºC | |
| Name | N-(1-adamantyl)-2,2,2-trifluoroethanimine |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 234.1ºC at 760 mmHg |
| Molecular Formula | C12H16F3N |
| Molecular Weight | 231.25700 |
| Flash Point | 95.4ºC |
| Exact Mass | 231.12300 |
| PSA | 12.36000 |
| LogP | 3.58830 |
| Index of Refraction | 1.569 |
| InChIKey | XGEDZBBTGDETFW-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C=NC12CC3CC(CC(C3)C1)C2 |
|
~%
N-(1-adamantyl)... CAS#:31185-52-1 |
| Literature: Crank; Harding; Szinai Journal of medicinal chemistry, 1970 , vol. 13, # 6 p. 1212 - 1215 |