4-ethyl-1-(1,1,2,2,2-pentafluoroethyl)-3,5,8-trioxabicyclo[2.2.2]octane structure
|
Common Name | 4-ethyl-1-(1,1,2,2,2-pentafluoroethyl)-3,5,8-trioxabicyclo[2.2.2]octane | ||
|---|---|---|---|---|
| CAS Number | 31185-66-7 | Molecular Weight | 262.17400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11F5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-ethyl-1-(1,1,2,2,2-pentafluoroethyl)-3,5,8-trioxabicyclo[2.2.2]octane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11F5O3 |
|---|---|
| Molecular Weight | 262.17400 |
| Exact Mass | 262.06300 |
| PSA | 27.69000 |
| LogP | 2.31120 |
| InChIKey | MVEILCHVGHQHFT-UHFFFAOYSA-N |
| SMILES | CCC12OCC(C(F)(F)C(F)(F)F)(CO1)CO2 |
| Orthopropionic acid,pentafluoro-,cyclic ester with 2-ethyl-2-(hydroxymethyl)-1,3-propanediol (1:1) |
| Pentafluoroorthopropionic acid cyclic ester with 2-ethyl-2-(hydroxymethyl)-1,3-propanediol |
| 1-ethyl-4-(pentafluoroethyl)-2,6,7-trioxabicyclo[2.2.2]octane |