Benzenesulfonothioicacid, 4-(1,1-dimethylethyl)-, S-[4-(1,1-dimethylethyl)phenyl] ester structure
|
Common Name | Benzenesulfonothioicacid, 4-(1,1-dimethylethyl)-, S-[4-(1,1-dimethylethyl)phenyl] ester | ||
|---|---|---|---|---|
| CAS Number | 31197-50-9 | Molecular Weight | 362.54900 | |
| Density | 1.15g/cm3 | Boiling Point | 472.8ºC at 760 mmHg | |
| Molecular Formula | C20H26O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.7ºC | |
| Name | 1-tert-butyl-4-(4-tert-butylphenyl)sulfonylsulfanylbenzene |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 472.8ºC at 760 mmHg |
| Molecular Formula | C20H26O2S2 |
| Molecular Weight | 362.54900 |
| Flash Point | 239.7ºC |
| Exact Mass | 362.13700 |
| PSA | 67.82000 |
| LogP | 6.84340 |
| Index of Refraction | 1.585 |
| InChIKey | LNSCDFKIZQSIQL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(SS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| HS Code | 2930909090 |
|---|
|
~%
Benzenesulfonot... CAS#:31197-50-9 |
| Literature: Carloni; Carloni, Patricia; Damiani; Damiani, Elisabetta; Iacussi; Iacussi, Marco; Greci; Greci, Lucedio; Stipa; Stipa, Pierluigi; Cauzi; Cauzi, Daniele; Rizzoli; Rizzoli, Corrado; Sgarabotto; Sgarabotto, Paolo Tetrahedron, 1995 , vol. 51, # 45 p. 12445 - 12452 |
|
~%
Benzenesulfonot... CAS#:31197-50-9 |
| Literature: Carloni; Carloni, Patricia; Damiani; Damiani, Elisabetta; Iacussi; Iacussi, Marco; Greci; Greci, Lucedio; Stipa; Stipa, Pierluigi; Cauzi; Cauzi, Daniele; Rizzoli; Rizzoli, Corrado; Sgarabotto; Sgarabotto, Paolo Tetrahedron, 1995 , vol. 51, # 45 p. 12445 - 12452 |
|
~%
Benzenesulfonot... CAS#:31197-50-9 |
| Literature: Lehto; Shirley Journal of Organic Chemistry, 1957 , vol. 22, p. 1254 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |