Hexanoic acid,3,3'-thiobis[4,4,5,5,6,6,6-heptafluoro- structure
|
Common Name | Hexanoic acid,3,3'-thiobis[4,4,5,5,6,6,6-heptafluoro- | ||
|---|---|---|---|---|
| CAS Number | 312-14-1 | Molecular Weight | 514.23200 | |
| Density | 1.674g/cm3 | Boiling Point | 368.5ºC at 760mmHg | |
| Molecular Formula | C12H8F14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.7ºC | |
| Name | 3-(1-carboxy-3,3,4,4,5,5,5-heptafluoropentan-2-yl)sulfanyl-4,4,5,5,6,6,6-heptafluorohexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.674g/cm3 |
|---|---|
| Boiling Point | 368.5ºC at 760mmHg |
| Molecular Formula | C12H8F14O4S |
| Molecular Weight | 514.23200 |
| Flash Point | 176.7ºC |
| Exact Mass | 513.99200 |
| PSA | 99.90000 |
| LogP | 5.07200 |
| Index of Refraction | 1.377 |
| InChIKey | WRVMOWWHPGYRJJ-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(SC(CC(=O)O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
|
~%
Hexanoic acid,3... CAS#:312-14-1 |
| Literature: McBee et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 2323 |
|
~%
Hexanoic acid,3... CAS#:312-14-1 |
| Literature: McBee et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 2323 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,5-bis-heptafluoropropyl-4-thia-heptanedioic acid |
| 3,3'-sulfanediylbis(4,4,5,5,6,6,6-heptafluorohexanoic acid) |
| Bis-(1-carboxymethyl-1H-heptafluor-butyl)-sulfid |
| 3,5-Bis(heptafluorpropyl)-4-thia-heptandisaeure |