1-fluoro-4-(phenylsulphonyl)benzene structure
|
Common Name | 1-fluoro-4-(phenylsulphonyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 312-31-2 | Molecular Weight | 236.26200 | |
| Density | 1.298g/cm3 | Boiling Point | 373.4ºC at 760mmHg | |
| Molecular Formula | C12H9FO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.7ºC | |
| Name | 1-(benzenesulfonyl)-4-fluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 373.4ºC at 760mmHg |
| Molecular Formula | C12H9FO2S |
| Molecular Weight | 236.26200 |
| Flash Point | 179.7ºC |
| Exact Mass | 236.03100 |
| PSA | 42.52000 |
| LogP | 3.73930 |
| Index of Refraction | 1.577 |
| InChIKey | MONGUDQJUIVFPI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(F)cc1 |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Sulfone,p-fluorophenyl phenyl |
| 4-fluorophenyl phenyl sulfone |