Benzenesulfonic acid,4-fluoro-, 2-chloroethyl ester structure
|
Common Name | Benzenesulfonic acid,4-fluoro-, 2-chloroethyl ester | ||
|---|---|---|---|---|
| CAS Number | 312-65-2 | Molecular Weight | 238.66400 | |
| Density | 1.406g/cm3 | Boiling Point | 360.5ºC at 760mmHg | |
| Molecular Formula | C8H8ClFO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.8ºC | |
| Name | 2-chloroethyl 4-fluorobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.406g/cm3 |
|---|---|
| Boiling Point | 360.5ºC at 760mmHg |
| Molecular Formula | C8H8ClFO3S |
| Molecular Weight | 238.66400 |
| Flash Point | 171.8ºC |
| Exact Mass | 237.98700 |
| PSA | 51.75000 |
| LogP | 2.85060 |
| Index of Refraction | 1.519 |
| InChIKey | OAXFFPTVLXBWHL-UHFFFAOYSA-N |
| SMILES | O=S(=O)(OCCCl)c1ccc(F)cc1 |
|
~32%
Benzenesulfonic... CAS#:312-65-2 |
| Literature: Shealy, Y. Fulmer; Krauth, Charles A.; Struck, Robert F.; Montgomery, John A. Journal of Medicinal Chemistry, 1983 , vol. 26, # 8 p. 1168 - 1173 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-fluoro-benzenesulfonic acid-(2-chloro-ethyl ester) |
| 4-Fluor-benzolsulfonsaeure-(2-chlor-aethylester) |