4-(Dimethylamino)-2-[2-(dimethylamino)ethyl]-2-phenylbutyramide structure
|
Common Name | 4-(Dimethylamino)-2-[2-(dimethylamino)ethyl]-2-phenylbutyramide | ||
|---|---|---|---|---|
| CAS Number | 3120-59-0 | Molecular Weight | 277.40500 | |
| Density | 1.025g/cm3 | Boiling Point | 441.8ºC at 760mmHg | |
| Molecular Formula | C16H27N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221ºC | |
| Name | 4-(dimethylamino)-2-[2-(dimethylamino)ethyl]-2-phenylbutanamide |
|---|
| Density | 1.025g/cm3 |
|---|---|
| Boiling Point | 441.8ºC at 760mmHg |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.40500 |
| Flash Point | 221ºC |
| Exact Mass | 277.21500 |
| PSA | 50.56000 |
| LogP | 2.46280 |
| Index of Refraction | 1.529 |
| InChIKey | GAMSVHKCGRVPPR-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(CCN(C)C)(C(N)=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |