Benzeneacetonitrile, a-[4-(hydroxyimino)-2,5-cyclohexadien-1-ylidene]-4-methoxy- structure
|
Common Name | Benzeneacetonitrile, a-[4-(hydroxyimino)-2,5-cyclohexadien-1-ylidene]-4-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 3122-39-2 | Molecular Weight | 252.26800 | |
| Density | 1.13g/cm3 | Boiling Point | 454.7ºC at 760mmHg | |
| Molecular Formula | C15H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.8ºC | |
| Name | 2-(4-hydroxyiminocyclohexa-2,5-dien-1-ylidene)-2-(4-methoxyphenyl)acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 454.7ºC at 760mmHg |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.26800 |
| Flash Point | 228.8ºC |
| Exact Mass | 252.09000 |
| PSA | 65.61000 |
| LogP | 2.92858 |
| Index of Refraction | 1.578 |
| InChIKey | CDNLWJKHJRCMDV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C#N)=C2C=CC(=NO)C=C2)cc1 |
|
~%
Benzeneacetonit... CAS#:3122-39-2 |
| Literature: Dore Ch.; Viel European Journal of Medicinal Chemistry, 1975 , vol. 10, # 1 p. 47 - 54 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-[4-(hydroxyimino)cyclohexa-2,5-dien-1-ylidene]-2-(4-methoxyphenyl)acetonitrile |
| HMS562K11 |
| HMS2803M10 |
| p-Methoxyphenylcyanomethylenchinon-oxim |
| p-Methoxyphenylcyanomethylen-p-benzochinon-oxim |