Ibuverine structure
|
Common Name | Ibuverine | ||
|---|---|---|---|---|
| CAS Number | 31221-85-9 | Molecular Weight | 290.39700 | |
| Density | 1.077g/cm3 | Boiling Point | 408.8ºC at 760 mmHg | |
| Molecular Formula | C18H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162ºC | |
| Name | 2-methylpropyl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.077g/cm3 |
|---|---|
| Boiling Point | 408.8ºC at 760 mmHg |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.39700 |
| Flash Point | 162ºC |
| Exact Mass | 290.18800 |
| PSA | 46.53000 |
| LogP | 3.65370 |
| Index of Refraction | 1.526 |
| InChIKey | ARZBHIWSBXERKM-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)C(O)(c1ccccc1)C1CCCCC1 |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Ibuverine |
| Ibuverino |
| Ibuverine [INN] |
| Hexahydrobenzilsaeureisobutylester |
| Ibuverinum |