1-(1-hydroxycyclohexyl)-3-(4-methoxyphenyl)propan-1-one structure
|
Common Name | 1-(1-hydroxycyclohexyl)-3-(4-methoxyphenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 312318-69-7 | Molecular Weight | 262.34400 | |
| Density | 1.119g/cm3 | Boiling Point | 407.3ºC at 760 mmHg | |
| Molecular Formula | C16H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.4ºC | |
| Name | 1-(1-hydroxycyclohexyl)-3-(4-methoxyphenyl)propan-1-one |
|---|
| Density | 1.119g/cm3 |
|---|---|
| Boiling Point | 407.3ºC at 760 mmHg |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.34400 |
| Flash Point | 146.4ºC |
| Exact Mass | 262.15700 |
| PSA | 46.53000 |
| LogP | 2.89210 |
| Index of Refraction | 1.545 |
| InChIKey | WKBCGFKBGIWXAW-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCC(=O)C2(O)CCCCC2)cc1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |