Carbamic acid,(ethylmethylsilylene)dimethylene ester (7CI,8CI) structure
|
Common Name | Carbamic acid,(ethylmethylsilylene)dimethylene ester (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 3124-53-6 | Molecular Weight | 220.29800 | |
| Density | 1.134g/cm3 | Boiling Point | 416.6ºC at 760mmHg | |
| Molecular Formula | C7H16N2O4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.7ºC | |
| Name | (carbamoyloxymethyl-ethyl-methylsilyl)methyl carbamate |
|---|
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 416.6ºC at 760mmHg |
| Molecular Formula | C7H16N2O4Si |
| Molecular Weight | 220.29800 |
| Flash Point | 205.7ºC |
| Exact Mass | 220.08800 |
| PSA | 104.64000 |
| LogP | 2.59110 |
| Index of Refraction | 1.466 |
| InChIKey | WFDCJUXAKGJEHU-UHFFFAOYSA-N |
| SMILES | CC[Si](C)(COC(N)=O)COC(N)=O |
|
~%
Carbamic acid,(... CAS#:3124-53-6 |
| Literature: Fessenden; Coon Journal of medicinal chemistry, 1965 , vol. 8, # 5 p. 604 - 608 |
|
~%
Carbamic acid,(... CAS#:3124-53-6 |
| Literature: Fessenden; Coon Journal of medicinal chemistry, 1965 , vol. 8, # 5 p. 604 - 608 |
|
~%
Carbamic acid,(... CAS#:3124-53-6 |
| Literature: Fessenden; Coon Journal of medicinal chemistry, 1965 , vol. 8, # 5 p. 604 - 608 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |