Platinum octaethylporphyrin structure
|
Common Name | Platinum octaethylporphyrin | ||
|---|---|---|---|---|
| CAS Number | 31248-39-2 | Molecular Weight | 737.91900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H54N4Pt | Melting Point | >300ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 2,3,7,8,12,13,17,18-octaethyl-1,4,5,10,11,14,15,20,21,23-decahydroporphyrin-22,24-diide,platinum(2+) |
|---|---|
| Synonym | More Synonyms |
| Melting Point | >300ºC |
|---|---|
| Molecular Formula | C36H54N4Pt |
| Molecular Weight | 737.91900 |
| Exact Mass | 737.40000 |
| PSA | 49.84000 |
| LogP | 7.30350 |
| InChIKey | WAODGUVBNLMTSF-UHFFFAOYSA-N |
| SMILES | CCC1=C(CC)c2cc3[n-]c(cc4[n-]c(cc5nc(cc1n2)C(CC)=C5CC)c(CC)c4CC)c(CC)c3CC.[Pt+2] |
| RIDADR | NONH for all modes of transport |
|---|
|
Recent progress of molecular organic electroluminescent materials and devices Hung, L.S.; et al.
Mater. Sci. Eng. R. Rep. 39 , 143 - 222, (2002)
|
|
|
Jabbour, G.E.; Wang, J.-F.; Peyghambarian, N.
Appl. Phys. Lett. 80 , 2026-2028, (2002)
|
|
|
Thin film dissolved oxygen sensor based on platinum octaethylporphyrin encapsulated in an elastic fluorinated polymer. Gillanders RN, et al.
Anal. Chim. Acta
|
| 4,7a-dimethyl-7,7a-dihydro-1,5(6H)-indenedione |
| 4,7a-Dimethyl-2,3,6,7-tetrahydroindene-1,5-dione |
| 4,7a-dimethyl-2,3,7,7a-tetrahydro-1H-indene-1,5(6H)-dione |
| (RS)-4,7a-dimethyl-2,3,7,7a-tetrahydro-(6H)-indene-1,5-dione |
| 2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphyrinoplatinum(II) |
| 2,6-dimethylbicyclo<4.3.0>non-1-en-3,7-dione |
| platinum(II)-2,3,7,8,12,13,17.18-octaethyl-21H,23H-porphyrin |
| 2,3,7,8,12,13,17,18-octaethyl-12H,23H-porphine platinum (II) |
| 4,7a-dimethyl-2,3,7,7a-tetrahydro-6H-indene-1,5-dione |
| (7aS)-4,7a-Dimethyl-5,6,7,7a-tetrahydroindan-1,5-dione |
| (2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphyrin)platinum(II) |
| Platinum octaethylporphyrin |