4-(2,5-Dihydroxyphenyl)benzoic acid structure
|
Common Name | 4-(2,5-Dihydroxyphenyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 31256-22-1 | Molecular Weight | 230.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2,5-Dihydroxyphenyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10O4 |
|---|---|
| Molecular Weight | 230.21600 |
| Exact Mass | 230.05800 |
| PSA | 77.76000 |
| LogP | 2.46300 |
| InChIKey | VSEKSHQBGNBUAW-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2cc(O)ccc2O)cc1 |
| HS Code | 2922299090 |
|---|
|
~%
4-(2,5-Dihydrox... CAS#:31256-22-1 |
| Literature: Kvalnes Journal of the American Chemical Society, 1934 , vol. 56, p. 2478,2479 |
|
~%
4-(2,5-Dihydrox... CAS#:31256-22-1 |
| Literature: Kvalnes Journal of the American Chemical Society, 1934 , vol. 56, p. 2478,2479 |
|
~%
4-(2,5-Dihydrox... CAS#:31256-22-1 |
| Literature: Kvalnes Journal of the American Chemical Society, 1934 , vol. 56, p. 2478,2479 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2',5'-Dihydroxy-biphenyl-4-carbonsaeure |
| 2',5'-dihydroxy-biphenyl-4-carboxylic acid |
| p-carboxyphenylhydroquinone |
| 4-(2.5-Dihydroxy-phenyl)-benzoesaeure |