Fumaric acid,bis(2,4,6-trichlorophenyl) ester (7CI,8CI) structure
|
Common Name | Fumaric acid,bis(2,4,6-trichlorophenyl) ester (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 31263-10-2 | Molecular Weight | 474.93400 | |
| Density | 1.632g/cm3 | Boiling Point | 566.2ºC at 760 mmHg | |
| Molecular Formula | C16H6Cl6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.1ºC | |
| Name | bis(2,4,6-trichlorophenyl) but-2-enedioate |
|---|
| Density | 1.632g/cm3 |
|---|---|
| Boiling Point | 566.2ºC at 760 mmHg |
| Molecular Formula | C16H6Cl6O4 |
| Molecular Weight | 474.93400 |
| Flash Point | 212.1ºC |
| Exact Mass | 471.84000 |
| PSA | 52.60000 |
| LogP | 6.67420 |
| Index of Refraction | 1.622 |
| InChIKey | PVAYWDBKLFNXLA-OWOJBTEDSA-N |
| SMILES | O=C(C=CC(=O)Oc1c(Cl)cc(Cl)cc1Cl)Oc1c(Cl)cc(Cl)cc1Cl |
|
~%
Fumaric acid,bi... CAS#:31263-10-2 |
| Literature: Spatz,S.M. Journal of Organic Chemistry, 1961 , vol. 26, p. 4158 - 4161 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |