(5-amino-1,3-dimethylpyrazol-4-yl)-(2-fluorophenyl)methanone structure
|
Common Name | (5-amino-1,3-dimethylpyrazol-4-yl)-(2-fluorophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 31272-21-6 | Molecular Weight | 233.24200 | |
| Density | 1.29g/cm3 | Boiling Point | 423.7ºC at 760mmHg | |
| Molecular Formula | C12H12FN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210ºC | |
| Name | (5-amino-1,3-dimethylpyrazol-4-yl)-(2-fluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 423.7ºC at 760mmHg |
| Molecular Formula | C12H12FN3O |
| Molecular Weight | 233.24200 |
| Flash Point | 210ºC |
| Exact Mass | 233.09600 |
| PSA | 60.91000 |
| LogP | 2.26200 |
| Index of Refraction | 1.607 |
| InChIKey | LMBRFPRUZRLJAW-UHFFFAOYSA-N |
| SMILES | Cc1nn(C)c(N)c1C(=O)c1ccccc1F |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Amino-1,3-dimethyl-4-pyrazolyl o-fluorophenyl ketone |
| Ketone,5-amino-1,3-dimethylpyrazol-4-yl o-fluorophenyl |
| KETONE,5-AMINO-1,3-DIMETHYL-4-PYRAZOLYL o-FLUOROPHENYL |