Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate
Modify Date: 2026-09-22 19:06:20
Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate structure
|
Common Name | Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate | ||
|---|---|---|---|---|
| CAS Number | 313-24-6 | Molecular Weight | 239.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16F3NO2 |
|---|---|
| Molecular Weight | 239.23 |
| InChIKey | ZLQALRYSSQUUET-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=C(N(CC)CC)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate? |
| A: InChIKey of Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate is ZLQALRYSSQUUET-UHFFFAOYSA-N. |
| Q: What is the CAS number of Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate? |
| A: CAS number of Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate is 313-24-6. |
| Q: What is the molecular formula of Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate? |
| A: Molecular formula of Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate is C10H16F3NO2. |
| Q: What is the SMILES notation of Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate? |
| A: SMILES notation of Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate is CCOC(=O)C=C(N(CC)CC)C(F)(F)F. |
| Q: What is the Chinese name of 313-24-6? |
| A: Chinese name of 313-24-6 is 313-24-6. |
| Q: What is the English name of Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate? |
| A: The English name of Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate is Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate. |
| Q: What is the molecular weight of Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate? |
| A: Molecular weight of Ethyl 3-(diethylamino)-4,4,4-trifluoro-2-butenoate is 239.23. |