Pentafluorobenzenesulfonicacid
Modify Date: 2025-09-22 11:38:23
Pentafluorobenzenesulfonicacid structure
|
Common Name | Pentafluorobenzenesulfonicacid | ||
|---|---|---|---|---|
| CAS Number | 313-50-8 | Molecular Weight | 248.12700 | |
| Density | 1.862g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6HF5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Pentafluorobenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.862g/cm3 |
|---|---|
| Molecular Formula | C6HF5O3S |
| Molecular Weight | 248.12700 |
| Exact Mass | 247.95700 |
| PSA | 62.75000 |
| LogP | 2.70960 |
| Index of Refraction | 1.477 |
| InChIKey | IKMBXKGUMLSBOT-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1c(F)c(F)c(F)c(F)c1F |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Pentafluorphenyl-allyl-ether |
| pentafluorophenylsulfonic acid |
| pentafluorophenyl-prop-2-enyl ether |
| 2,3,4,5,6-pentafluoro-benzenesulfonic acid |
| Pentafluorphenyl-prop-2-enylether |
| perfluorobenzensulfonic acid |
| Pentafluor-benzolsulfonsaeure |
| Allyl pentafluorophenyl ether |
| pentafluoro-benzenesulfonic acid |