4-aminophenyl-alpha-d-glucopyranoside
Modify Date: 2025-08-25 19:03:00
4-aminophenyl-alpha-d-glucopyranoside structure
|
Common Name | 4-aminophenyl-alpha-d-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 31302-52-0 | Molecular Weight | 271.26600 | |
| Density | 1.517 | Boiling Point | 556℃ | |
| Molecular Formula | C12H17NO6 | Melting Point | 185-186℃ | |
| MSDS | N/A | Flash Point | 290℃ | |
| Name | (2R,3R,4S,5R,6R)-2-(4-aminophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.517 |
|---|---|
| Boiling Point | 556℃ |
| Melting Point | 185-186℃ |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.26600 |
| Flash Point | 290℃ |
| Exact Mass | 271.10600 |
| PSA | 125.40000 |
| InChIKey | MIAKOEWBCMPCQR-UHFFFAOYSA-N |
| SMILES | Nc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1 |
|
~92%
4-aminophenyl-a... CAS#:31302-52-0 |
| Literature: Amaike; Kobayashi; Shinkai Bulletin of the Chemical Society of Japan, 2000 , vol. 73, # 11 p. 2553 - 2558 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Aminophenyl a-D-glucopyranoside |
| 1efi |