methyl N-[2-[4-[bis(2-chloroethyl)amino]anilino]-2-oxoethyl]carbamate
Modify Date: 2025-09-06 13:11:23
![methyl N-[2-[4-[bis(2-chloroethyl)amino]anilino]-2-oxoethyl]carbamate Structure](https://image.chemsrc.com/caspic/239/3131-18-8.png)
methyl N-[2-[4-[bis(2-chloroethyl)amino]anilino]-2-oxoethyl]carbamate structure
|
Common Name | methyl N-[2-[4-[bis(2-chloroethyl)amino]anilino]-2-oxoethyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 3131-18-8 | Molecular Weight | 348.22500 | |
| Density | 1.331g/cm3 | Boiling Point | 575.3ºC at 760mmHg | |
| Molecular Formula | C14H19Cl2N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.7ºC | |
| Name | methyl N-[2-[4-[bis(2-chloroethyl)amino]anilino]-2-oxoethyl]carbamate |
|---|
| Density | 1.331g/cm3 |
|---|---|
| Boiling Point | 575.3ºC at 760mmHg |
| Molecular Formula | C14H19Cl2N3O3 |
| Molecular Weight | 348.22500 |
| Flash Point | 301.7ºC |
| Exact Mass | 347.08000 |
| PSA | 74.16000 |
| LogP | 2.54250 |
| Index of Refraction | 1.591 |
| InChIKey | RPAFZRCNUFPYCK-UHFFFAOYSA-N |
| SMILES | COC(=O)NCC(=O)Nc1ccc(N(CCCl)CCCl)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |