[4-[(2-aminoacetyl)amino]phenyl]-bis(2-chloroethyl)azanium,chloride structure
|
Common Name | [4-[(2-aminoacetyl)amino]phenyl]-bis(2-chloroethyl)azanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 3131-20-2 | Molecular Weight | 326.65000 | |
| Density | N/A | Boiling Point | 503.6ºC at 760 mmHg | |
| Molecular Formula | C12H18Cl3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.4ºC | |
| Name | [4-[(2-aminoacetyl)amino]phenyl]-bis(2-chloroethyl)azanium,chloride |
|---|
| Boiling Point | 503.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H18Cl3N3O |
| Molecular Weight | 326.65000 |
| Flash Point | 258.4ºC |
| Exact Mass | 325.05200 |
| PSA | 58.36000 |
| LogP | 3.44310 |
| InChIKey | ICKWCFIMGINONV-UHFFFAOYSA-N |
| SMILES | NCC(=O)Nc1ccc([NH+](CCCl)CCCl)cc1.[Cl-] |
|
~%
[4-[(2-aminoace... CAS#:3131-20-2 |
| Literature: Bergel; Stock Journal of the Chemical Society, 1959 , p. 97 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |