Dichloromethylphenylsilane
Modify Date: 2026-06-22 22:25:35
Dichloromethylphenylsilane structure
|
Common Name | Dichloromethylphenylsilane | ||
|---|---|---|---|---|
| CAS Number | 31324-77-3 | Molecular Weight | 191.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H8Cl2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dichloromethylphenylsilane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H8Cl2Si |
|---|---|
| Molecular Weight | 191.13 |
| InChIKey | GNEPOXWQWFSSOU-UHFFFAOYSA-N |
| SMILES | C[Si](C1=CC=CC=C1)(Cl)Cl |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: qHTS assay for small molecule antagonists of farnesoid X receptor signaling
Source: NCGC
Target: farnesoid X nuclear receptor [Homo sapiens]
External Id: FXRN10
|
|
Name: qHTS assay for small molecule agonists of farnesoid X receptor signaling
Source: NCGC
Target: farnesoid X nuclear receptor [Homo sapiens]
External Id: FXRA10
|
|
Name: qHTS assay for small molecule agonists of the antioxidant response element (ARE) sign...
Source: NCGC
Target: N/A
External Id: ARE853
|
|
Name: qHTS assay for small molecule agonists of retinoid X receptor alpha signaling
Source: NCGC
Target: retinoid X nuclear receptor alpha [Homo sapiens]
External Id: RXRA10
|
|
Name: qHTS assay for small molecule agonists of thyroid hormone receptor beta signaling
Source: NCGC
Target: thyroid hormone receptor beta [Homo sapiens]
External Id: TRBA10
|
|
Name: qHTS assay for small molecule antagonists of estrogen receptor alpha signaling
Source: NCGC
Target: estrogen nuclear receptor alpha [Homo sapiens]
External Id: ERN101
|
|
Name: qHTS assay for small molecule agonists of estrogen receptor alpha signaling
Source: NCGC
Target: estrogen nuclear receptor alpha [Homo sapiens]
External Id: ERA101
|
|
Name: qHTS assay for small molecule antagonists of retinoid X receptor alpha signaling
Source: NCGC
Target: retinoid X nuclear receptor alpha [Homo sapiens]
External Id: RXRN10
|
|
Name: qHTS assay for small molecule antagonists of thyroid hormone receptor beta signaling
Source: NCGC
Target: thyroid hormone receptor beta [Homo sapiens]
External Id: TRBN10
|
|
Name: qHTS assay for small molecule agonists of androgen receptor signaling
Source: NCGC
Target: AR protein [Homo sapiens]
External Id: ARA101
|
Total 23, Current Page 1 of 3
1
2
3
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Dichloromethylphenylsilane? |
| A: InChIKey of Dichloromethylphenylsilane is GNEPOXWQWFSSOU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Dichloromethylphenylsilane? |
| A: Molecular weight of Dichloromethylphenylsilane is 191.13. |
| Q: What is the Chinese name of 31324-77-3? |
| A: Chinese name of 31324-77-3 is 31324-77-3. |
| Q: What is the SMILES notation of Dichloromethylphenylsilane? |
| A: SMILES notation of Dichloromethylphenylsilane is C[Si](C1=CC=CC=C1)(Cl)Cl. |
| Q: What is the CAS number of Dichloromethylphenylsilane? |
| A: CAS number of Dichloromethylphenylsilane is 31324-77-3. |
| Q: What is the English name of Dichloromethylphenylsilane? |
| A: The English name of Dichloromethylphenylsilane is Dichloromethylphenylsilane. |
| Q: What is the molecular formula of Dichloromethylphenylsilane? |
| A: Molecular formula of Dichloromethylphenylsilane is C7H8Cl2Si. |