9H-Fluoren-9-one,2-methoxy- structure
|
Common Name | 9H-Fluoren-9-one,2-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 3133-07-1 | Molecular Weight | 210.22800 | |
| Density | 1.245g/cm3 | Boiling Point | 383.6ºC at 760mmHg | |
| Molecular Formula | C14H10O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.3ºC | |
| Name | 2-methoxyfluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 383.6ºC at 760mmHg |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 210.22800 |
| Flash Point | 186.3ºC |
| Exact Mass | 210.06800 |
| PSA | 26.30000 |
| LogP | 2.90660 |
| Index of Refraction | 1.637 |
| InChIKey | QNBZCSMULZKFNV-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)C(=O)c1ccccc1-2 |
| HS Code | 2914509090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 9H-Fluoren-9-one,2-methoxy |
| 2-methoxy-9h-fluoren-9-one |
| 2-Methoxyfluorenon |
| 2-methoxy-9-fluorenone |
| 2-methoxy-fluorenone |
| 2-methoxy-fluoren-9-one |