2-[4-[(Cyclopentylamino)carbonyl]-1H-pyrazol-1-yl]-Adenosine
Modify Date: 2026-04-19 09:25:04
![2-[4-[(Cyclopentylamino)carbonyl]-1H-pyrazol-1-yl]-Adenosine Structure](https://www.chemsrc.com/extcaspic/225/313348-37-7.png)
2-[4-[(Cyclopentylamino)carbonyl]-1H-pyrazol-1-yl]-Adenosine structure
|
Common Name | 2-[4-[(Cyclopentylamino)carbonyl]-1H-pyrazol-1-yl]-Adenosine | ||
|---|---|---|---|---|
| CAS Number | 313348-37-7 | Molecular Weight | 444.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24N8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[4-[(Cyclopentylamino)carbonyl]-1H-pyrazol-1-yl]-Adenosine |
|---|
| Molecular Formula | C19H24N8O5 |
|---|---|
| Molecular Weight | 444.4 |
| InChIKey | OMYIZCDTYNHUGF-XWXWGSFUSA-N |
| SMILES | C1CCC(C1)NC(=O)C2=CN(N=C2)C3=NC(=C4C(=N3)N(C=N4)[C@H]5[C@@H]([C@@H]([C@H](O5)CO)O)O)N |
|
Name: Receptor binding affinity for the adenosine A2A receptor was determined using [3H]ZM-...
Source: ChEMBL
Target: Adenosine receptor A2a
External Id: CHEMBL640587
|
|
Name: Receptor binding affinity for the adenosine A2A receptor were determined using [3H]ZM...
Source: ChEMBL
Target: Adenosine receptor A2a
External Id: CHEMBL640535
|
Total 2, Current Page 1 of 1
1