2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide
Modify Date: 2026-06-29 05:54:27
![2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide Structure](https://www.chemsrc.com/extcaspic/007/313481-35-5.png)
2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide structure
|
Common Name | 2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 313481-35-5 | Molecular Weight | 306.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14N4O3S |
|---|---|
| Molecular Weight | 306.34 |
| InChIKey | YMQHXEMFAIZWSC-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(NC1=O)SCC(=O)NC2=CC=C(C=C2)OC |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Identification of CBX7 inhibitors - Primary Alpha Screen
Source: 15290
Target: N/A
External Id: CBX7-Alpha-primary
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide? |
| A: SMILES notation of 2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide is CC1=NN=C(NC1=O)SCC(=O)NC2=CC=C(C=C2)OC. |
| Q: What is the English name of 2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide? |
| A: The English name of 2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide is 2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide. |
| Q: What is the InChIKey of 2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide? |
| A: InChIKey of 2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide is YMQHXEMFAIZWSC-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide? |
| A: Molecular formula of 2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide is C13H14N4O3S. |
| Q: What is the CAS number of 2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide? |
| A: CAS number of 2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide is 313481-35-5. |
| Q: What is the molecular weight of 2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide? |
| A: Molecular weight of 2-[(5-hydroxy-6-methyl-1,2,4-triazin-3-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide is 306.34. |
| Q: What is the Chinese name of 313481-35-5? |
| A: Chinese name of 313481-35-5 is 313481-35-5. |