2-[(3-fluoro-4-methylphenyl)methyl]benzoic acid structure
|
Common Name | 2-[(3-fluoro-4-methylphenyl)methyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 313505-74-7 | Molecular Weight | 244.26100 | |
| Density | 1.21g/cm3 | Boiling Point | 374.8ºC at 760 mmHg | |
| Molecular Formula | C15H13FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.5ºC | |
| Name | 2-[(3-fluoro-4-methylphenyl)methyl]benzoic acid |
|---|
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 374.8ºC at 760 mmHg |
| Molecular Formula | C15H13FO2 |
| Molecular Weight | 244.26100 |
| Flash Point | 180.5ºC |
| Exact Mass | 244.09000 |
| PSA | 37.30000 |
| LogP | 3.42310 |
| Index of Refraction | 1.581 |
| InChIKey | NONIPMXEAJZBOX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cc2ccccc2C(=O)O)cc1F |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |