5,7-Dimethoxytryptamine
Modify Date: 2025-09-13 13:45:36
5,7-Dimethoxytryptamine structure
|
Common Name | 5,7-Dimethoxytryptamine | ||
|---|---|---|---|---|
| CAS Number | 31363-75-4 | Molecular Weight | 220.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,7-Dimethoxytryptamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16N2O2 |
|---|---|
| Molecular Weight | 220.27 |
| InChIKey | QLAMFTLRTDNOLB-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2[nH]cc(CCN)c2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5,7-Dimethoxytryptamine? |
| A: Molecular formula of 5,7-Dimethoxytryptamine is C12H16N2O2. |
| Q: What is the molecular weight of 5,7-Dimethoxytryptamine? |
| A: Molecular weight of 5,7-Dimethoxytryptamine is 220.27. |
| Q: What is the SMILES notation of 5,7-Dimethoxytryptamine? |
| A: SMILES notation of 5,7-Dimethoxytryptamine is COc1cc(OC)c2[nH]cc(CCN)c2c1. |
| Q: What is the CAS number of 5,7-Dimethoxytryptamine? |
| A: CAS number of 5,7-Dimethoxytryptamine is 31363-75-4. |
| Q: What is the Chinese name of 31363-75-4? |
| A: Chinese name of 31363-75-4 is 31363-75-4. |
| Q: What is the English name of 5,7-Dimethoxytryptamine? |
| A: The English name of 5,7-Dimethoxytryptamine is 5,7-Dimethoxytryptamine. |
| Q: What is the InChIKey of 5,7-Dimethoxytryptamine? |
| A: InChIKey of 5,7-Dimethoxytryptamine is QLAMFTLRTDNOLB-UHFFFAOYSA-N. |