18,19-seco-apicularen A
Modify Date: 2025-08-26 23:16:28
18,19-seco-apicularen A structure
|
Common Name | 18,19-seco-apicularen A | ||
|---|---|---|---|---|
| CAS Number | 313644-61-0 | Molecular Weight | 318.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 18,19-seco-apicularen A |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H22O5 |
|---|---|
| Molecular Weight | 318.4 |
| InChIKey | QNYXNHZIVGPFHM-CBBWQLFWSA-N |
| SMILES | C=CCC1CC2CC(O)CC(Cc3cccc(O)c3C(=O)O1)O2 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 313644-61-0? |
| A: Chinese name of 313644-61-0 is 313644-61-0. |
| Q: What is the CAS number of 18,19-seco-apicularen A? |
| A: CAS number of 18,19-seco-apicularen A is 313644-61-0. |
| Q: What is the molecular formula of 18,19-seco-apicularen A? |
| A: Molecular formula of 18,19-seco-apicularen A is C18H22O5. |
| Q: What is the English name of 18,19-seco-apicularen A? |
| A: The English name of 18,19-seco-apicularen A is 18,19-seco-apicularen A. |
| Q: What is the molecular weight of 18,19-seco-apicularen A? |
| A: Molecular weight of 18,19-seco-apicularen A is 318.4. |
| Q: What is the InChIKey of 18,19-seco-apicularen A? |
| A: InChIKey of 18,19-seco-apicularen A is QNYXNHZIVGPFHM-CBBWQLFWSA-N. |
| Q: What is the SMILES notation of 18,19-seco-apicularen A? |
| A: SMILES notation of 18,19-seco-apicularen A is C=CCC1CC2CC(O)CC(Cc3cccc(O)c3C(=O)O1)O2. |