Benzoic acid, 4-amino-,4-nitrophenyl ester structure
|
Common Name | Benzoic acid, 4-amino-,4-nitrophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 31366-38-8 | Molecular Weight | 258.22900 | |
| Density | 1.381g/cm3 | Boiling Point | 481.5ºC at 760mmHg | |
| Molecular Formula | C13H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophenyl) 4-aminobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.381g/cm3 |
|---|---|
| Boiling Point | 481.5ºC at 760mmHg |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.22900 |
| Exact Mass | 258.06400 |
| PSA | 98.14000 |
| LogP | 3.50060 |
| Index of Refraction | 1.655 |
| InChIKey | IDQAOTGARKTEOL-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
|
~56%
Benzoic acid, 4... CAS#:31366-38-8 |
| Literature: Stewart, Frederick H. C. Australian Journal of Chemistry, 1983 , vol. 36, # 8 p. 1629 - 1638 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-nitrophenyl p-aminobenzoate |
| 4-nitrophenyl 4-aminobenzoate |