4-Iodophenyl 2,2-diphenylacetate
Modify Date: 2026-06-12 09:42:36
4-Iodophenyl 2,2-diphenylacetate structure
|
Common Name | 4-Iodophenyl 2,2-diphenylacetate | ||
|---|---|---|---|---|
| CAS Number | 313670-52-9 | Molecular Weight | 414.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H15IO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Iodophenyl 2,2-diphenylacetate |
|---|
| Molecular Formula | C20H15IO2 |
|---|---|
| Molecular Weight | 414.2 |
| InChIKey | ANVJOOWHUJQQPE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)OC3=CC=C(C=C3)I |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1